N,N-bis(2-azidoethyl)-Sulfamoyl fluoride
Modify Date: 2026-09-15 18:00:07
N,N-bis(2-azidoethyl)-Sulfamoyl fluoride structure
|
Common Name | N,N-bis(2-azidoethyl)-Sulfamoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 1839621-36-1 | Molecular Weight | 237.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H8FN7O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N,N-bis(2-azidoethyl)-Sulfamoyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4H8FN7O2S |
|---|---|
| Molecular Weight | 237.22 |
| InChIKey | ULNGQTQBJUPEFK-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCN(CCN=[N+]=[N-])S(=O)(=O)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride? |
| A: Molecular formula of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride is C4H8FN7O2S. |
| Q: What is the Chinese name of 1839621-36-1? |
| A: Chinese name of 1839621-36-1 is 1839621-36-1. |
| Q: What is the SMILES notation of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride? |
| A: SMILES notation of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride is [N-]=[N+]=NCCN(CCN=[N+]=[N-])S(=O)(=O)F. |
| Q: What is the molecular weight of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride? |
| A: Molecular weight of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride is 237.22. |
| Q: What is the InChIKey of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride? |
| A: InChIKey of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride is ULNGQTQBJUPEFK-UHFFFAOYSA-N. |
| Q: What is the English name of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride? |
| A: The English name of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride is N,N-bis(2-azidoethyl)-Sulfamoyl fluoride. |
| Q: What is the CAS number of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride? |
| A: CAS number of N,N-bis(2-azidoethyl)-Sulfamoyl fluoride is 1839621-36-1. |