Fluorotrinitromethane structure
|
Common Name | Fluorotrinitromethane | ||
|---|---|---|---|---|
| CAS Number | 1840-42-2 | Molecular Weight | 169.02600 | |
| Density | 1.901g/cm3 | Boiling Point | 103.4ºC at 760 mmHg | |
| Molecular Formula | CFN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 16.3ºC | |
| Name | fluoro(trinitro)methane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.901g/cm3 |
|---|---|
| Boiling Point | 103.4ºC at 760 mmHg |
| Molecular Formula | CFN3O6 |
| Molecular Weight | 169.02600 |
| Flash Point | 16.3ºC |
| Exact Mass | 168.97700 |
| PSA | 137.46000 |
| LogP | 0.96690 |
| Vapour Pressure | 32.3mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | IHOVZLJULZIGOW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(F)([N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Fluortrinitromethan |
| METHANE,FLUOROTRINITRO |
| Fluorotrinitromethane |