methyl-phenyl-di(propan-2-yloxy)silane structure
|
Common Name | methyl-phenyl-di(propan-2-yloxy)silane | ||
|---|---|---|---|---|
| CAS Number | 18406-11-6 | Molecular Weight | 238.39800 | |
| Density | 0.93g/cm3 | Boiling Point | 263ºC at 760 mmHg | |
| Molecular Formula | C13H22O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.2ºC | |
| Name | methyl-phenyl-di(propan-2-yloxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.93g/cm3 |
|---|---|
| Boiling Point | 263ºC at 760 mmHg |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.39800 |
| Flash Point | 139.2ºC |
| Exact Mass | 238.13900 |
| PSA | 18.46000 |
| LogP | 2.81560 |
| Vapour Pressure | 0.0172mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | QAUVQFQRFPDWFD-UHFFFAOYSA-N |
| SMILES | CC(C)O[Si](C)(OC(C)C)c1ccccc1 |
|
~85%
methyl-phenyl-d... CAS#:18406-11-6 |
| Literature: Lorenz, Catrin; Schubert, Ulrich Chemische Berichte, 1995 , vol. 128, # 12 p. 1267 - 1270 |
|
~%
methyl-phenyl-d... CAS#:18406-11-6 |
| Literature: Chappelow et al. Journal of Chemical and Engineering Data, 1963 , vol. 8, p. 82 |
| Di-iso-propoxy-phenyl-methylsilan |
| phenylmethyldiisopropyloxysilane |
| diisopropoxy-methyl-phenyl-silane |
| Diisopropyloxy-methyl-phenyl-silan |