4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]
Modify Date: 2025-09-11 17:47:25
![4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] Structure](https://www.chemsrc.com/extcaspic/340/1840887-43-5.png)
4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] structure
|
Common Name | 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] | ||
|---|---|---|---|---|
| CAS Number | 1840887-43-5 | Molecular Weight | 391.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24F3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24F3N3O |
|---|---|
| Molecular Weight | 391.4 |
| InChIKey | KMTPDWKJUJZSCU-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C=CCNC1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1840887-43-5? |
| A: Chinese name of 1840887-43-5 is 1840887-43-5. |
| Q: What is the CAS number of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]? |
| A: CAS number of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] is 1840887-43-5. |
| Q: What is the molecular weight of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]? |
| A: Molecular weight of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] is 391.4. |
| Q: What is the molecular formula of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]? |
| A: Molecular formula of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] is C21H24F3N3O. |
| Q: What is the InChIKey of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]? |
| A: InChIKey of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] is KMTPDWKJUJZSCU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]? |
| A: SMILES notation of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] is COc1ccccc1C=CCNC1CCN(c2ccc(C(F)(F)F)cn2)CC1. |
| Q: What is the English name of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]? |
| A: The English name of 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl] is 4-Piperidinamine, N-[3-(2-methoxyphenyl)-2-propen-1-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]. |