Benzenamine,N,N-bis(2-chloroethyl)-4-[[(4-fluorophenyl)imino]methyl]-2-methoxy- structure
|
Common Name | Benzenamine,N,N-bis(2-chloroethyl)-4-[[(4-fluorophenyl)imino]methyl]-2-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 1841-72-1 | Molecular Weight | 369.26100 | |
| Density | 1.19g/cm3 | Boiling Point | 482.7ºC at 760 mmHg | |
| Molecular Formula | C18H19Cl2FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.7ºC | |
| Name | p-Fluor-{3-methoxy-4-[N,N-bis-(2-chlor-ethyl)-amino]-benzyliden}-anilin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 482.7ºC at 760 mmHg |
| Molecular Formula | C18H19Cl2FN2O |
| Molecular Weight | 369.26100 |
| Flash Point | 245.7ºC |
| Exact Mass | 368.08600 |
| PSA | 24.83000 |
| LogP | 4.86890 |
| Vapour Pressure | 1.79E-09mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | UXPROHURAKRHSX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=NC2=CC=C(C=C2)F)N(CCCl)CCCl |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N,N-bis(2-chloroethyl)-4-[(4-fluorophenyl)iminomethyl]-2-methoxy-anili ne |