1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Modify Date: 2025-09-09 19:45:04
![1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine Structure](https://www.chemsrc.com/extcaspic/460/1841080-79-2.png)
1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine structure
|
Common Name | 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 1841080-79-2 | Molecular Weight | 203.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13N5 |
|---|---|
| Molecular Weight | 203.24 |
| InChIKey | HRJUAYZDZZKHQQ-UHFFFAOYSA-N |
| SMILES | C=Cc1nn(C(C)C)c2ncnc(N)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine? |
| A: Molecular weight of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is 203.24. |
| Q: What is the molecular formula of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine? |
| A: Molecular formula of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is C10H13N5. |
| Q: What is the CAS number of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine? |
| A: CAS number of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is 1841080-79-2. |
| Q: What is the InChIKey of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine? |
| A: InChIKey of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is HRJUAYZDZZKHQQ-UHFFFAOYSA-N. |
| Q: What is the English name of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine? |
| A: The English name of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine. |
| Q: What is the Chinese name of 1841080-79-2? |
| A: Chinese name of 1841080-79-2 is 1841080-79-2. |
| Q: What is the SMILES notation of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine? |
| A: SMILES notation of 1-Isopropyl-3-vinyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is C=Cc1nn(C(C)C)c2ncnc(N)c12. |