Phosphoric acid 2-[[amino(imino)methyl]amino]ethyl[(S)-2-carboxy-2-aminoethyl] ester structure
|
Common Name | Phosphoric acid 2-[[amino(imino)methyl]amino]ethyl[(S)-2-carboxy-2-aminoethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 18416-85-8 | Molecular Weight | 270.18000 | |
| Density | 1.83g/cm3 | Boiling Point | 540.9ºC at 760 mmHg | |
| Molecular Formula | C6H15N4O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.9ºC | |
| Name | L-lombricine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.83g/cm3 |
|---|---|
| Boiling Point | 540.9ºC at 760 mmHg |
| Molecular Formula | C6H15N4O6P |
| Molecular Weight | 270.18000 |
| Flash Point | 280.9ºC |
| Exact Mass | 270.07300 |
| PSA | 190.79000 |
| Vapour Pressure | 3.9E-13mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | GSDBGCKBBJVPNC-BYPYZUCNSA-N |
| SMILES | NC(N)=NCCOP(=O)(O)OCC(N)C(=O)O |
|
~95%
Phosphoric acid... CAS#:18416-85-8 |
| Literature: Euerby, Melvin R.; Partridge, Lynda Z.; Gibbons, William A. Journal of Chemical Research, Miniprint, 1988 , # 12 p. 3028 - 3051 |
|
~%
Phosphoric acid... CAS#:18416-85-8 |
| Literature: Beatty,I.M.; Magrath,D.I. Journal of the American Chemical Society, 1960 , vol. 82, p. 4983 - 4989 |
| (2S)-2-amino-3-[2-(diaminomethylideneamino)ethoxy-hydroxyphosphoryl]oxypropanoic acid |
| Lombricine |
| L-Lombricin |
| Lombricin |
| L-Lombricine |