4-Cyano-2-(trifluoromethyl)phenylhydrazine structure
|
Common Name | 4-Cyano-2-(trifluoromethyl)phenylhydrazine | ||
|---|---|---|---|---|
| CAS Number | 184163-56-2 | Molecular Weight | 201.14900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydrazinyl-3-(trifluoromethyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6F3N3 |
|---|---|
| Molecular Weight | 201.14900 |
| Exact Mass | 201.05100 |
| PSA | 61.84000 |
| LogP | 2.63598 |
| InChIKey | AGGXBOOGNPKSRU-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(NN)c(C(F)(F)F)c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| pc7498 |