Diphenylvinylchlorosilane structure
|
Common Name | Diphenylvinylchlorosilane | ||
|---|---|---|---|---|
| CAS Number | 18419-53-9 | Molecular Weight | 244.792 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 303.7±15.0 °C at 760 mmHg | |
| Molecular Formula | C14H13ClSi | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 126.7±10.3 °C | |
| Name | chloro-ethenyl-diphenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.7±15.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C14H13ClSi |
| Molecular Weight | 244.792 |
| Flash Point | 126.7±10.3 °C |
| Exact Mass | 244.047501 |
| LogP | 6.28 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | PLMTWHZZBPGADP-UHFFFAOYSA-N |
| SMILES | C=C[Si](Cl)(c1ccccc1)c1ccccc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39-45-27-22 |
| RIDADR | UN 2987 |
| HS Code | 2931900090 |
|
~68%
Diphenylvinylch... CAS#:18419-53-9 |
| Literature: Savela, Risto; Zawartka, Wojciech; Leino, Reko Organometallics, 2012 , vol. 31, # 8 p. 3199 - 3206 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Diphenylvinylchlorosilane |
| Silane,chlorodiphenylvinyl |
| Vinyldiphenylchlorosilane |
| Silane,chloroethenyldiphenyl |
| Chloro(diphenyl)vinylsilane |
| Ph2(vinyl)SiCl |
| chlorodiphenyl(vinyl)silane |
| Silane, chlorodiphenylvinyl- |
| diphenylvinylsilyl chloride |
| chloranyl-ethenyl-diphenyl-silane |
| Silane, chloroethenyldiphenyl- |
| Benzene, 1,1'-(chloroethenylsilylene)bis- |