N-[(R)-3,4-Dihydro-8-hydroxy-3α-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl-L-phenylalanine ethyl ester structure
|
Common Name | N-[(R)-3,4-Dihydro-8-hydroxy-3α-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl-L-phenylalanine ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 18420-71-8 | Molecular Weight | 397.42100 | |
| Density | 1.269g/cm3 | Boiling Point | 609.7ºC at 760 mmHg | |
| Molecular Formula | C22H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.6ºC | |
| Name | ethyl 2-[(8-hydroxy-3-methyl-1-oxo-3,4-dihydroisochromene-7-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 609.7ºC at 760 mmHg |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.42100 |
| Flash Point | 322.6ºC |
| Exact Mass | 397.15300 |
| PSA | 105.42000 |
| LogP | 2.97260 |
| Vapour Pressure | 1.84E-15mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | XXAVUHHKDMGGBR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccccc1)NC(=O)c1ccc2c(c1O)C(=O)OC(C)C2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| o-chlorophenyltrimethylsilyloxymalonic acid dinitrile |
| Ochratoxin-B-ethylester |