Tert-butyl 2-formyl-6-nitrobenzoate
Modify Date: 2025-09-09 17:47:37
Tert-butyl 2-formyl-6-nitrobenzoate structure
|
Common Name | Tert-butyl 2-formyl-6-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 1842385-34-5 | Molecular Weight | 251.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 2-formyl-6-nitrobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13NO5 |
|---|---|
| Molecular Weight | 251.23 |
| InChIKey | SVYTXROTVQMPHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1c(C=O)cccc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Tert-butyl 2-formyl-6-nitrobenzoate? |
| A: InChIKey of Tert-butyl 2-formyl-6-nitrobenzoate is SVYTXROTVQMPHC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Tert-butyl 2-formyl-6-nitrobenzoate? |
| A: Molecular formula of Tert-butyl 2-formyl-6-nitrobenzoate is C12H13NO5. |
| Q: What is the molecular weight of Tert-butyl 2-formyl-6-nitrobenzoate? |
| A: Molecular weight of Tert-butyl 2-formyl-6-nitrobenzoate is 251.23. |
| Q: What is the CAS number of Tert-butyl 2-formyl-6-nitrobenzoate? |
| A: CAS number of Tert-butyl 2-formyl-6-nitrobenzoate is 1842385-34-5. |
| Q: What is the SMILES notation of Tert-butyl 2-formyl-6-nitrobenzoate? |
| A: SMILES notation of Tert-butyl 2-formyl-6-nitrobenzoate is CC(C)(C)OC(=O)c1c(C=O)cccc1[N+](=O)[O-]. |
| Q: What is the Chinese name of 1842385-34-5? |
| A: Chinese name of 1842385-34-5 is 1842385-34-5. |
| Q: What is the English name of Tert-butyl 2-formyl-6-nitrobenzoate? |
| A: The English name of Tert-butyl 2-formyl-6-nitrobenzoate is Tert-butyl 2-formyl-6-nitrobenzoate. |