4,6-ditert-butyl-1,3,2-diazaphosphinine structure
|
Common Name | 4,6-ditert-butyl-1,3,2-diazaphosphinine | ||
|---|---|---|---|---|
| CAS Number | 184243-13-8 | Molecular Weight | 211.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20N2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,6-ditert-butyl-1,3,2-diazaphosphinine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H20N2P |
|---|---|
| Molecular Weight | 211.26400 |
| Exact Mass | 211.13600 |
| PSA | 48.19000 |
| LogP | 3.06540 |
| InChIKey | BXCHDFGELAPRBO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)npn1 |
|
~%
4,6-ditert-buty... CAS#:184243-13-8 |
| Literature: Avarvari, Narcis; Le Floch, Pascal; Mathey, Francois Journal of the American Chemical Society, 1996 , vol. 118, # 47 p. 11978 - 11979 |
| 3,5-di-tert-butyl-1,3,2-diazaphosphinine |
| 4,6-di-tert-butyl-1,3,2-diazaphosphinine |