1-(2,3-dihydro-1,4-benzodioxin-5-yloxy)-3-(propan-2-ylamino)propan-2-ol structure
|
Common Name | 1-(2,3-dihydro-1,4-benzodioxin-5-yloxy)-3-(propan-2-ylamino)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1843-82-9 | Molecular Weight | 267.32100 | |
| Density | 1.152g/cm3 | Boiling Point | 434.7ºC at 760mmHg | |
| Molecular Formula | C14H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.7ºC | |
| Name | 1-(2,3-dihydro-1,4-benzodioxin-5-yloxy)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760mmHg |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32100 |
| Flash Point | 216.7ºC |
| Exact Mass | 267.14700 |
| PSA | 59.95000 |
| LogP | 1.58640 |
| Vapour Pressure | 2.51E-08mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | NLUUGSAKIXOSLG-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)COc1cccc2c1OCCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzodixine |