ethyl 4-chloroquinoline-2-carboxylate structure
|
Common Name | ethyl 4-chloroquinoline-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 18436-69-6 | Molecular Weight | 235.66600 | |
| Density | 1.286g/cm3 | Boiling Point | 357.5ºC at 760mmHg | |
| Molecular Formula | C12H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170ºC | |
| Name | ethyl 4-chloroquinoline-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 357.5ºC at 760mmHg |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.66600 |
| Flash Point | 170ºC |
| Exact Mass | 235.04000 |
| PSA | 39.19000 |
| LogP | 3.06490 |
| Vapour Pressure | 2.72E-05mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | POWYXUDTZJAGFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(Cl)c2ccccc2n1 |
| HS Code | 2933499090 |
|---|
|
~%
ethyl 4-chloroq... CAS#:18436-69-6 |
| Literature: Journal of Organic Chemistry, , vol. 15, p. 600,604 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloroquinaldic acid,ethyl ester |
| 4-chloro-quinoline-2-carboxylic acid ethyl ester |
| 4-Chlor-chinolin-2-carbonsaeure-aethylester |
| 4-chloro-2-ethoxycarbonylquinoline |