4-Chloro-8-(1,1-dimethylethyl)quinoline
Modify Date: 2026-07-07 12:21:31
4-Chloro-8-(1,1-dimethylethyl)quinoline structure
|
Common Name | 4-Chloro-8-(1,1-dimethylethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 18436-74-3 | Molecular Weight | 219.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-8-(1,1-dimethylethyl)quinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14ClN |
|---|---|
| Molecular Weight | 219.71 |
| InChIKey | OCTXPUWGIVZAFC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cccc2c(Cl)ccnc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Chloro-8-(1,1-dimethylethyl)quinoline? |
| A: Molecular formula of 4-Chloro-8-(1,1-dimethylethyl)quinoline is C13H14ClN. |
| Q: What is the Chinese name of 18436-74-3? |
| A: Chinese name of 18436-74-3 is 18436-74-3. |
| Q: What is the InChIKey of 4-Chloro-8-(1,1-dimethylethyl)quinoline? |
| A: InChIKey of 4-Chloro-8-(1,1-dimethylethyl)quinoline is OCTXPUWGIVZAFC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-Chloro-8-(1,1-dimethylethyl)quinoline? |
| A: CAS number of 4-Chloro-8-(1,1-dimethylethyl)quinoline is 18436-74-3. |
| Q: What is the molecular weight of 4-Chloro-8-(1,1-dimethylethyl)quinoline? |
| A: Molecular weight of 4-Chloro-8-(1,1-dimethylethyl)quinoline is 219.71. |
| Q: What is the English name of 4-Chloro-8-(1,1-dimethylethyl)quinoline? |
| A: The English name of 4-Chloro-8-(1,1-dimethylethyl)quinoline is 4-Chloro-8-(1,1-dimethylethyl)quinoline. |
| Q: What is the SMILES notation of 4-Chloro-8-(1,1-dimethylethyl)quinoline? |
| A: SMILES notation of 4-Chloro-8-(1,1-dimethylethyl)quinoline is CC(C)(C)c1cccc2c(Cl)ccnc12. |