4-chloro-7-nitroquinoline
4-chloro-7-nitroquinoline structure
|
Common Name | 4-chloro-7-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 18436-76-5 | Molecular Weight | 208.60100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-7-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5ClN2O2 |
|---|---|
| Molecular Weight | 208.60100 |
| Exact Mass | 208.00400 |
| PSA | 58.71000 |
| LogP | 3.31960 |
| InChIKey | UPZGWWDLHRREJM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(Cl)ccnc2c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933499090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![diethyl 2-[(3-nitroanilino)methylidene]propanedioate structure](https://image.chemsrc.com/caspic/337/40107-10-6.png)
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-nitro-4-chloroquinoline |
| 4-Chlor-7-nitrochinolin |
| Quinoline,4-chloro-7-nitro |
| 4-chloro-7-nitro-quinoline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-chloro-7-nitroquinoline have? |
| A: English synonyms of 4-chloro-7-nitroquinoline: 7-nitro-4-chloroquinoline, 4-Chlor-7-nitrochinolin, Quinoline,4-chloro-7-nitro, 4-chloro-7-nitro-quinoline. |
| Q: What is the English name of 4-chloro-7-nitroquinoline? |
| A: The English name of 4-chloro-7-nitroquinoline is 4-chloro-7-nitroquinoline. |
| Q: What is the molecular weight of 4-chloro-7-nitroquinoline? |
| A: Molecular weight of 4-chloro-7-nitroquinoline is 208.60100. |
| Q: What is the SMILES notation of 4-chloro-7-nitroquinoline? |
| A: SMILES notation of 4-chloro-7-nitroquinoline is O=[N+]([O-])c1ccc2c(Cl)ccnc2c1. |
| Q: What is the CAS number of 4-chloro-7-nitroquinoline? |
| A: CAS number of 4-chloro-7-nitroquinoline is 18436-76-5. |
| Q: What is the InChIKey of 4-chloro-7-nitroquinoline? |
| A: InChIKey of 4-chloro-7-nitroquinoline is UPZGWWDLHRREJM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-chloro-7-nitroquinoline? |
| A: Molecular formula of 4-chloro-7-nitroquinoline is C9H5ClN2O2. |
| Q: What is the LogP of 4-chloro-7-nitroquinoline? |
| A: LogP of 4-chloro-7-nitroquinoline is 3.31960. |
| Q: What is the polar surface area (PSA) of 4-chloro-7-nitroquinoline? |
| A: Polar surface area (PSA) of 4-chloro-7-nitroquinoline is 58.71000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |