Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy
Modify Date: 2026-08-03 14:41:02
![Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy Structure](https://www.chemsrc.com/extcaspic/063/1844-64-0.png)
Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy structure
|
Common Name | Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy | ||
|---|---|---|---|---|
| CAS Number | 1844-64-0 | Molecular Weight | 259.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10ClN3O |
|---|---|
| Molecular Weight | 259.69 |
| InChIKey | MUHOBOJQYDCNIG-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(-c3ccc(Cl)cc3)cn2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy? |
| A: SMILES notation of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy is COc1ccc2nc(-c3ccc(Cl)cc3)cn2n1. |
| Q: What is the Chinese name of 1844-64-0? |
| A: Chinese name of 1844-64-0 is 1844-64-0. |
| Q: What is the molecular formula of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy? |
| A: Molecular formula of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy is C13H10ClN3O. |
| Q: What is the English name of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy? |
| A: The English name of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy is Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy. |
| Q: What is the molecular weight of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy? |
| A: Molecular weight of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy is 259.69. |
| Q: What is the CAS number of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy? |
| A: CAS number of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy is 1844-64-0. |
| Q: What is the InChIKey of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy? |
| A: InChIKey of Imidazo[1,2-b]pyridazine,2-(4-chlorophenyl)-6-methoxy is MUHOBOJQYDCNIG-UHFFFAOYSA-N. |