2,2'-Dimethyl-5,5'-bis(1-methylethenyl)-3,3'-bicyclohexane-1,1'-dione structure
|
Common Name | 2,2'-Dimethyl-5,5'-bis(1-methylethenyl)-3,3'-bicyclohexane-1,1'-dione | ||
|---|---|---|---|---|
| CAS Number | 18457-34-6 | Molecular Weight | 302.45100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-3-(2-methyl-3-oxo-5-prop-1-en-2-ylcyclohexyl)-5-prop-1-en-2-ylcyclohexan-1-one |
|---|
| Molecular Formula | C20H30O2 |
|---|---|
| Molecular Weight | 302.45100 |
| Exact Mass | 302.22500 |
| PSA | 34.14000 |
| LogP | 4.60140 |
| InChIKey | GVMQRYCIHSDNRX-UHFFFAOYSA-N |
| SMILES | C=C(C)C1CC(=O)C(C)C(C2CC(C(=C)C)CC(=O)C2C)C1 |
|
~%
2,2'-Dimethyl-5... CAS#:18457-34-6 |
| Literature: Grimshaw,J.; Trocha-Grimshaw,J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 2584 - 2587 |