2-[(1,3-dioxoisoindol-2-yl)-methoxycarbonyl-methyl]-5,5-dimethyl-thiazolidine-4-carboxylic acid structure
|
Common Name | 2-[(1,3-dioxoisoindol-2-yl)-methoxycarbonyl-methyl]-5,5-dimethyl-thiazolidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 18461-15-9 | Molecular Weight | 378.40000 | |
| Density | 1.424g/cm3 | Boiling Point | 579.8ºC at 760 mmHg | |
| Molecular Formula | C17H18N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.4ºC | |
| Name | 2-[1-(1,3-dioxoisoindol-2-yl)-2-methoxy-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 579.8ºC at 760 mmHg |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.40000 |
| Flash Point | 304.4ºC |
| Exact Mass | 378.08900 |
| PSA | 138.31000 |
| LogP | 0.98520 |
| Vapour Pressure | 2.77E-14mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | CFLMGIZSXQYPJM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1NC(C(=O)O)C(C)(C)S1)N1C(=O)c2ccccc2C1=O |
|
~%
2-[(1,3-dioxois... CAS#:18461-15-9 |
| Literature: Sheehan; Johnson Journal of the American Chemical Society, 1954 , vol. 76, p. 158 |
|
~%
2-[(1,3-dioxois... CAS#:18461-15-9 |
| Literature: Sheehan; Johnson Journal of the American Chemical Society, 1954 , vol. 76, p. 158 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |