Hydrazine,[2-(1,3-benzodioxol-5-yl)-1-methylethyl]-, hydrochloride (1:1) structure
|
Common Name | Hydrazine,[2-(1,3-benzodioxol-5-yl)-1-methylethyl]-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 18477-08-2 | Molecular Weight | 230.69100 | |
| Density | 1.193g/cm3 | Boiling Point | 359.3ºC at 760mmHg | |
| Molecular Formula | C10H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
| Name | 1-(1,3-benzodioxol-5-yl)propan-2-ylhydrazine,hydrochloride |
|---|
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 359.3ºC at 760mmHg |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69100 |
| Flash Point | 171.1ºC |
| Exact Mass | 230.08200 |
| PSA | 56.51000 |
| LogP | 2.70280 |
| InChIKey | CSFSBGWNSJTVFN-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccc2c(c1)OCO2)NN.Cl |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|