5-piperazin-1-yl-1H-indole structure
|
Common Name | 5-piperazin-1-yl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 184899-15-8 | Molecular Weight | 201.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-piperazin-1-yl-1H-indole |
|---|
| Molecular Formula | C12H15N3 |
|---|---|
| Molecular Weight | 201.26800 |
| Exact Mass | 201.12700 |
| PSA | 31.06000 |
| LogP | 1.97130 |
| InChIKey | MZILCLREQQTZJP-UHFFFAOYSA-N |
| SMILES | c1cc2cc(N3CCNCC3)ccc2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~%
5-piperazin-1-y... CAS#:184899-15-8 |
| Literature: EP1396487 A1, ; Page 15 ; |
|
~%
5-piperazin-1-y... CAS#:184899-15-8 |
| Literature: US2007/43058 A1, ; Page/Page column 7 ; US 20070043058 A1 |
|
~17%
5-piperazin-1-y... CAS#:184899-15-8 |
| Literature: Merck Sharpe and Dohme Ltd. Patent: US5432177 A1, 1995 ; |
|
~86%
5-piperazin-1-y... CAS#:184899-15-8 |
| Literature: WAYNE STATE UNIVERSITY; DUTTA, Aloke, K. Patent: WO2014/85600 A1, 2014 ; Location in patent: Page/Page column 00073 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |