2,3-dichloro-6-methylpyridine N-oxide
Modify Date: 2026-07-17 17:52:21
2,3-dichloro-6-methylpyridine N-oxide structure
|
Common Name | 2,3-dichloro-6-methylpyridine N-oxide | ||
|---|---|---|---|---|
| CAS Number | 185017-75-8 | Molecular Weight | 178.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-dichloro-6-methylpyridine N-oxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5Cl2NO |
|---|---|
| Molecular Weight | 178.01 |
| InChIKey | BMZCDHZUXFQQAZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c(Cl)[n+]1[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,3-dichloro-6-methylpyridine N-oxide? |
| A: InChIKey of 2,3-dichloro-6-methylpyridine N-oxide is BMZCDHZUXFQQAZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,3-dichloro-6-methylpyridine N-oxide? |
| A: SMILES notation of 2,3-dichloro-6-methylpyridine N-oxide is Cc1ccc(Cl)c(Cl)[n+]1[O-]. |
| Q: What is the molecular formula of 2,3-dichloro-6-methylpyridine N-oxide? |
| A: Molecular formula of 2,3-dichloro-6-methylpyridine N-oxide is C6H5Cl2NO. |
| Q: What is the CAS number of 2,3-dichloro-6-methylpyridine N-oxide? |
| A: CAS number of 2,3-dichloro-6-methylpyridine N-oxide is 185017-75-8. |
| Q: What is the molecular weight of 2,3-dichloro-6-methylpyridine N-oxide? |
| A: Molecular weight of 2,3-dichloro-6-methylpyridine N-oxide is 178.01. |
| Q: What is the English name of 2,3-dichloro-6-methylpyridine N-oxide? |
| A: The English name of 2,3-dichloro-6-methylpyridine N-oxide is 2,3-dichloro-6-methylpyridine N-oxide. |
| Q: What is the Chinese name of 185017-75-8? |
| A: Chinese name of 185017-75-8 is 185017-75-8. |