Se-Aspirin (Selenium-acetylsalicylic Acid) structure
|
Common Name | Se-Aspirin (Selenium-acetylsalicylic Acid) | ||
|---|---|---|---|---|
| CAS Number | 1850293-95-6 | Molecular Weight | 311.195 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O3Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Se-Aspirin (Selenium-acetylsalicylic Acid)Se-Aspirin is a hybrid of selenium and a nonsteroidal anti-inflammatory agent. |
| Name | Se-Aspirin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O3Se |
|---|---|
| Molecular Weight | 311.195 |
| Exact Mass | 312.001312 |
| LogP | 1.06 |
| InChIKey | YJLOEJJBOLNYTM-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccccc1C(=O)NCC[Se]C#N |
| Selenocyanic acid, 2-[[2-(acetyloxy)benzoyl]amino]ethyl ester |
| 2-[(2-Selenocyanatoethyl)carbamoyl]phenyl acetate |