4-(4-tert-butylphenyl)oxane-2,6-dione
Modify Date: 2025-09-26 12:50:08
4-(4-tert-butylphenyl)oxane-2,6-dione structure
|
Common Name | 4-(4-tert-butylphenyl)oxane-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 185049-55-2 | Molecular Weight | 246.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-tert-butylphenyl)oxane-2,6-dione |
|---|
| Molecular Formula | C15H18O3 |
|---|---|
| Molecular Weight | 246.30200 |
| Exact Mass | 246.12600 |
| PSA | 43.37000 |
| LogP | 2.93130 |
| InChIKey | RCDUMUKBCQLEHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C2CC(=O)OC(=O)C2)cc1 |
|
~%
4-(4-tert-butyl... CAS#:185049-55-2 |
| Literature: Yang, Jerry; Gabriele, Bartolo; Belvedere, Sandro; Huang, Ying; Breslow, Ronald The Journal of organic chemistry, 2002 , vol. 67, # 15 p. 5057 - 5067 |
|
~%
4-(4-tert-butyl... CAS#:185049-55-2 |
| Literature: UNIVERSITAET DES SAARLANDES Patent: US2012/46307 A1, 2012 ; |
