R 715 structure
|
Common Name | R 715 | ||
|---|---|---|---|---|
| CAS Number | 185052-09-9 | Molecular Weight | 1140.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C57H81N13O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of R 715R715 is a selective bradykinin B1 receptor antagonist. R715 significantly attenuates the hyperalgesic effect developed in Streptozotocin(HY-13753)-diabetic mice[1]. |
| Name | r 715 |
|---|
| Description | R715 is a selective bradykinin B1 receptor antagonist. R715 significantly attenuates the hyperalgesic effect developed in Streptozotocin(HY-13753)-diabetic mice[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C57H81N13O12 |
|---|---|
| Molecular Weight | 1140.33000 |
| Exact Mass | 1139.61000 |
| PSA | 389.77000 |
| LogP | 3.67050 |
| InChIKey | DOSXOGUJJBDRGQ-VUBDHFCFSA-N |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc2ccccc2c1)NC(=O)C(CO)NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C(CCCCN)NC(C)=O)C(=O)O |