1-(chloromethyl)-4-methoxy-2,3,5,6-tetramethylbenzene structure
|
Common Name | 1-(chloromethyl)-4-methoxy-2,3,5,6-tetramethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 18508-47-9 | Molecular Weight | 212.71600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(chloromethyl)-4-methoxy-2,3,5,6-tetramethylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17ClO |
|---|---|
| Molecular Weight | 212.71600 |
| Exact Mass | 212.09700 |
| PSA | 9.23000 |
| LogP | 3.66760 |
| InChIKey | AGEYWRPMSLJVCP-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(C)c(CCl)c(C)c1C |
|
~%
1-(chloromethyl... CAS#:18508-47-9 |
| Literature: Bollinger,J.M. et al. Journal of the American Chemical Society, 1967 , vol. 89, p. 5687 - 5691 |
| 2,3,5,6,-Tetramethyl-4-methoxybenzylchlorid |
| 4-Methoxy-2,3,5,6-tetramethyl-benzylchlorid |
| 4-Methoxy-tetramethyl-benzylchlorid |