1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone
Modify Date: 2025-09-10 03:41:31
1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone structure
|
Common Name | 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone | ||
|---|---|---|---|---|
| CAS Number | 1851285-90-9 | Molecular Weight | 274.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13F3N2O2 |
|---|---|
| Molecular Weight | 274.24 |
| InChIKey | LKBRDOYIPKDONZ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1N)CCN(C(=O)C(F)(F)F)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone? |
| A: The English name of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone is 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone. |
| Q: What is the molecular formula of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone? |
| A: Molecular formula of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone is C12H13F3N2O2. |
| Q: What is the InChIKey of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone? |
| A: InChIKey of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone is LKBRDOYIPKDONZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone? |
| A: CAS number of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone is 1851285-90-9. |
| Q: What is the SMILES notation of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone? |
| A: SMILES notation of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone is COc1cc2c(cc1N)CCN(C(=O)C(F)(F)F)C2. |
| Q: What is the molecular weight of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone? |
| A: Molecular weight of 1-(6-Amino-7-methoxy-3,4-dihydroisoquinolin-2(1H)-YL)-2,2,2-trifluoroethanone is 274.24. |
| Q: What is the Chinese name of 1851285-90-9? |
| A: Chinese name of 1851285-90-9 is 1851285-90-9. |