Adenine,9-a-D-arabinopyranosyl-, 2',3',4'-triacetate (8CI) structure
|
Common Name | Adenine,9-a-D-arabinopyranosyl-, 2',3',4'-triacetate (8CI) | ||
|---|---|---|---|---|
| CAS Number | 18520-81-5 | Molecular Weight | 393.35100 | |
| Density | 1.62g/cm3 | Boiling Point | 568.1ºC at 760mmHg | |
| Molecular Formula | C16H19N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.4ºC | |
| Name | D-(1R)-tri-O-acetyl-1-(6-amino-purin-9-yl)-1,5-anhydro-xylitol |
|---|
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 568.1ºC at 760mmHg |
| Molecular Formula | C16H19N5O7 |
| Molecular Weight | 393.35100 |
| Flash Point | 297.4ºC |
| Exact Mass | 393.12800 |
| PSA | 157.75000 |
| LogP | 0.31360 |
| Vapour Pressure | 6.4E-13mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | LJUSHLYDDSZMCI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1COC(n2cnc3c(N)ncnc32)C(OC(C)=O)C1OC(C)=O |
|
~%
Adenine,9-a-D-a... CAS#:18520-81-5 |
| Literature: Davoll et al. Journal of the Chemical Society, 1946 , p. 833,835 Journal of the Chemical Society, 1948 , p. 967,968 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |