2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one
2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one structure
|
Common Name | 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 185244-57-9 | Molecular Weight | 285.13400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13BrO3 |
|---|---|
| Molecular Weight | 285.13400 |
| Exact Mass | 284.00500 |
| PSA | 35.53000 |
| LogP | 2.95810 |
| InChIKey | BIUHJCSPFGAWEZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)cc1OC1CCCC1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~69%
2-(5-bromo-2-me... CAS#:185244-57-9 |
| Literature: Van der Mey; Hatzelmann; Van Klink; Van der Laan; Sterk; Thibaut; Ulrich; Timmerman Journal of Medicinal Chemistry, 2001 , vol. 44, # 16 p. 2523 - 2535 |
|
~%
2-(5-bromo-2-me... CAS#:185244-57-9 |
| Literature: Van der Mey; Hatzelmann; Van Klink; Van der Laan; Sterk; Thibaut; Ulrich; Timmerman Journal of Medicinal Chemistry, 2001 , vol. 44, # 16 p. 2523 - 2535 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one? |
| A: Molecular weight of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one is 285.13400. |
| Q: What is the InChIKey of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one? |
| A: InChIKey of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one is BIUHJCSPFGAWEZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one? |
| A: Molecular formula of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one is C12H13BrO3. |
| Q: What is the CAS number of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one? |
| A: CAS number of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one is 185244-57-9. |
| Q: What is the Chinese name of 185244-57-9? |
| A: Chinese name of 185244-57-9 is 185244-57-9. |
| Q: What is the LogP of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one? |
| A: LogP of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one is 2.95810. |
| Q: What is the English name of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one? |
| A: The English name of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one is 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one. |
| Q: What is the polar surface area (PSA) of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one? |
| A: Polar surface area (PSA) of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one is 35.53000. |
| Q: What is the SMILES notation of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one? |
| A: SMILES notation of 2-(5-bromo-2-methoxyphenoxy)cyclopentan-1-one is COc1ccc(Br)cc1OC1CCCC1=O. |