3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride
3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride structure
|
Common Name | 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 185253-63-8 | Molecular Weight | 226.65600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11ClO3 |
|---|---|
| Molecular Weight | 226.65600 |
| Exact Mass | 226.04000 |
| PSA | 35.53000 |
| LogP | 2.48240 |
| InChIKey | VRLJVOPVODJEEG-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=CC(=O)Cl)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
3-(2,3-dimethox... CAS#:185253-63-8 |
| Literature: Burja, Bojan; Kocevar, Marijan; Polanc, Slovenko Tetrahedron, 2009 , vol. 65, # 42 p. 8690 - 8696 |
|
~%
3-(2,3-dimethox... CAS#:185253-63-8 |
| Literature: Otero, Elver; Robledo, Sara M.; Diaz, Santiago; Carda, Miguel; Munoz, Diana; Panos, Julian; Velez, Ivan D.; Cardona, Wilson Medicinal Chemistry Research, 2014 , vol. 23, # 3 p. 1378 - 1386 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride? |
| A: CAS number of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride is 185253-63-8. |
| Q: What is the LogP of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride? |
| A: LogP of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride is 2.48240. |
| Q: What is the Chinese name of 185253-63-8? |
| A: Chinese name of 185253-63-8 is 185253-63-8. |
| Q: What is the molecular formula of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride? |
| A: Molecular formula of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride is C11H11ClO3. |
| Q: What is the molecular weight of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride? |
| A: Molecular weight of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride is 226.65600. |
| Q: What is the InChIKey of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride? |
| A: InChIKey of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride is VRLJVOPVODJEEG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride? |
| A: SMILES notation of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride is COc1cccc(C=CC(=O)Cl)c1OC. |
| Q: What is the English name of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride? |
| A: The English name of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride is 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride. |
| Q: What is the polar surface area (PSA) of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride? |
| A: Polar surface area (PSA) of 3-(2,3-dimethoxyphenyl)prop-2-enoyl chloride is 35.53000. |