1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate
1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate structure
|
Common Name | 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 185424-25-3 | Molecular Weight | 316.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14F6O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H14F6O3S |
|---|---|
| Molecular Weight | 316.26100 |
| Exact Mass | 316.05700 |
| PSA | 51.75000 |
| LogP | 4.83470 |
| InChIKey | MOPQADBHDPUSHZ-UHFFFAOYSA-N |
| SMILES | CCCCCCC(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~69%
1,1,1-trifluoro... CAS#:185424-25-3 |
| Literature: Hagiwara, Toshiki; Tanaka, Katsumi; Fuchikami, Takamasa Tetrahedron Letters, 1996 , vol. 37, # 45 p. 8187 - 8190 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate? |
| A: Molecular formula of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate is C9H14F6O3S. |
| Q: What is the InChIKey of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate? |
| A: InChIKey of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate is MOPQADBHDPUSHZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 185424-25-3? |
| A: Chinese name of 185424-25-3 is 185424-25-3. |
| Q: What is the CAS number of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate? |
| A: CAS number of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate is 185424-25-3. |
| Q: What is the LogP of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate? |
| A: LogP of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate is 4.83470. |
| Q: What is the SMILES notation of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate? |
| A: SMILES notation of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate is CCCCCCC(OS(=O)(=O)C(F)(F)F)C(F)(F)F. |
| Q: What is the polar surface area (PSA) of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate? |
| A: Polar surface area (PSA) of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate is 51.75000. |
| Q: What is the molecular weight of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate? |
| A: Molecular weight of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate is 316.26100. |
| Q: What is the English name of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate? |
| A: The English name of 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate is 1,1,1-trifluorooctan-2-yl trifluoromethanesulfonate. |