(4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol
Modify Date: 2026-09-06 17:31:12
(4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol structure
|
Common Name | (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol | ||
|---|---|---|---|---|
| CAS Number | 1854902-75-2 | Molecular Weight | 569.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H45ClO4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C33H45ClO4Si |
|---|---|
| Molecular Weight | 569.2 |
| InChIKey | DWJMTSOGEWXIBG-YXQUNVLPSA-N |
| SMILES | CC(C)(C)[Si](OCCCC(O)CC(O)C(Cl)CCCOCc1ccccc1)(c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol? |
| A: The English name of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol is (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol. |
| Q: What is the CAS number of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol? |
| A: CAS number of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol is 1854902-75-2. |
| Q: What is the SMILES notation of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol? |
| A: SMILES notation of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol is CC(C)(C)[Si](OCCCC(O)CC(O)C(Cl)CCCOCc1ccccc1)(c1ccccc1)c1ccccc1. |
| Q: What is the molecular weight of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol? |
| A: Molecular weight of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol is 569.2. |
| Q: What is the molecular formula of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol? |
| A: Molecular formula of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol is C33H45ClO4Si. |
| Q: What is the Chinese name of 1854902-75-2? |
| A: Chinese name of 1854902-75-2 is 1854902-75-2. |
| Q: What is the InChIKey of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol? |
| A: InChIKey of (4S,6S,7R)-10-(Benzyloxy)-1-((tert-butyldiphenylsilyl)oxy)-7-chlorodecane-4,6-diol is DWJMTSOGEWXIBG-YXQUNVLPSA-N. |