4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide
Modify Date: 2026-07-06 07:01:57
4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide structure
|
Common Name | 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 1855927-77-3 | Molecular Weight | 333.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6BrFN2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H6BrFN2OS2 |
|---|---|
| Molecular Weight | 333.2 |
| InChIKey | GXVXUQZOBFMVJB-YIXHJXPBSA-N |
| SMILES | O=C(NN=Cc1ccc(F)s1)c1cc(Br)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide? |
| A: Molecular formula of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide is C10H6BrFN2OS2. |
| Q: What is the SMILES notation of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide? |
| A: SMILES notation of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide is O=C(NN=Cc1ccc(F)s1)c1cc(Br)cs1. |
| Q: What is the CAS number of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide? |
| A: CAS number of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide is 1855927-77-3. |
| Q: What is the Chinese name of 1855927-77-3? |
| A: Chinese name of 1855927-77-3 is 1855927-77-3. |
| Q: What is the English name of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide? |
| A: The English name of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide is 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide. |
| Q: What is the InChIKey of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide? |
| A: InChIKey of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide is GXVXUQZOBFMVJB-YIXHJXPBSA-N. |
| Q: What is the molecular weight of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide? |
| A: Molecular weight of 4-Bromo-N'-((5-fluorothiophen-2-yl)methylene)thiophene-2-carbohydrazide is 333.2. |