heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine
Modify Date: 2026-07-07 16:10:28
![heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine Structure](https://www.chemsrc.com/extcaspic/176/1855945-54-8.png)
heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine structure
|
Common Name | heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine | ||
|---|---|---|---|---|
| CAS Number | 1855945-54-8 | Molecular Weight | 277.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H22F3N3 |
|---|---|
| Molecular Weight | 277.33 |
| InChIKey | HAEDUFXCXKOKCL-UHFFFAOYSA-N |
| SMILES | CCCCCCCNCc1cnn(CC(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: Molecular weight of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine is 277.33. |
| Q: What is the SMILES notation of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: SMILES notation of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine is CCCCCCCNCc1cnn(CC(F)(F)F)c1. |
| Q: What is the English name of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: The English name of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine is heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine. |
| Q: What is the molecular formula of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: Molecular formula of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine is C13H22F3N3. |
| Q: What is the Chinese name of 1855945-54-8? |
| A: Chinese name of 1855945-54-8 is 1855945-54-8. |
| Q: What is the InChIKey of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: InChIKey of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine is HAEDUFXCXKOKCL-UHFFFAOYSA-N. |
| Q: What is the CAS number of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: CAS number of heptyl({[1-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]methyl})amine is 1855945-54-8. |