{[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine
Modify Date: 2026-08-05 16:31:48
![{[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine Structure](https://www.chemsrc.com/extcaspic/449/1856035-82-9.png)
{[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine structure
|
Common Name | {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine | ||
|---|---|---|---|---|
| CAS Number | 1856035-82-9 | Molecular Weight | 257.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23N3 |
|---|---|
| Molecular Weight | 257.37 |
| InChIKey | CEVJPMUXGIYEJF-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1cc(CNCCc2ccccc2)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine? |
| A: Molecular formula of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine is C16H23N3. |
| Q: What is the Chinese name of 1856035-82-9? |
| A: Chinese name of 1856035-82-9 is 1856035-82-9. |
| Q: What is the SMILES notation of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine? |
| A: SMILES notation of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine is CC(C)Cn1cc(CNCCc2ccccc2)cn1. |
| Q: What is the English name of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine? |
| A: The English name of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine is {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine. |
| Q: What is the molecular weight of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine? |
| A: Molecular weight of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine is 257.37. |
| Q: What is the InChIKey of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine? |
| A: InChIKey of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine is CEVJPMUXGIYEJF-UHFFFAOYSA-N. |
| Q: What is the CAS number of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine? |
| A: CAS number of {[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl}(2-phenylethyl)amine is 1856035-82-9. |