[3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine
Modify Date: 2026-07-06 09:28:59
-1H-pyrazol-4-yl]methyl})amine Structure](https://www.chemsrc.com/extcaspic/479/1856058-28-0.png)
[3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine structure
|
Common Name | [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine | ||
|---|---|---|---|---|
| CAS Number | 1856058-28-0 | Molecular Weight | 238.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H26N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H26N4 |
|---|---|
| Molecular Weight | 238.37 |
| InChIKey | WNOCGKSFZFHUFK-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1cc(CNCCCN(C)C)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: SMILES notation of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine is CC(C)Cn1cc(CNCCCN(C)C)cn1. |
| Q: What is the English name of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: The English name of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine is [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine. |
| Q: What is the Chinese name of 1856058-28-0? |
| A: Chinese name of 1856058-28-0 is 1856058-28-0. |
| Q: What is the molecular formula of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: Molecular formula of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine is C13H26N4. |
| Q: What is the CAS number of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: CAS number of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine is 1856058-28-0. |
| Q: What is the InChIKey of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: InChIKey of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine is WNOCGKSFZFHUFK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine? |
| A: Molecular weight of [3-(dimethylamino)propyl]({[1-(2-methylpropyl)-1H-pyrazol-4-yl]methyl})amine is 238.37. |