2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride
Modify Date: 2026-08-03 09:26:33
![2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride Structure](https://www.chemsrc.com/extcaspic/055/1856085-33-0.png)
2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride structure
|
Common Name | 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1856085-33-0 | Molecular Weight | 275.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12ClF2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12ClF2N3O |
|---|---|
| Molecular Weight | 275.68 |
| InChIKey | BGZCELZYJHOSGT-UHFFFAOYSA-N |
| SMILES | Cl.Oc1ccccc1CNc1ccn(C(F)F)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride? |
| A: SMILES notation of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride is Cl.Oc1ccccc1CNc1ccn(C(F)F)n1. |
| Q: What is the InChIKey of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride? |
| A: InChIKey of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride is BGZCELZYJHOSGT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride? |
| A: Molecular formula of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride is C11H12ClF2N3O. |
| Q: What is the molecular weight of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride? |
| A: Molecular weight of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride is 275.68. |
| Q: What is the CAS number of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride? |
| A: CAS number of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride is 1856085-33-0. |
| Q: What is the English name of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride? |
| A: The English name of 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride is 2-[[[1-(Difluoromethyl)pyrazol-3-yl]amino]methyl]phenol;hydrochloride. |
| Q: What is the Chinese name of 1856085-33-0? |
| A: Chinese name of 1856085-33-0 is 1856085-33-0. |