TRIFOLIOL structure
|
Common Name | TRIFOLIOL | ||
|---|---|---|---|---|
| CAS Number | 1857-26-7 | Molecular Weight | 298.24700 | |
| Density | 1.558g/cm3 | Boiling Point | 425ºC at 760 mmHg | |
| Molecular Formula | C16H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.8ºC | |
| Name | 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.558g/cm3 |
|---|---|
| Boiling Point | 425ºC at 760 mmHg |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.24700 |
| Flash Point | 210.8ºC |
| Exact Mass | 298.04800 |
| PSA | 93.04000 |
| LogP | 3.11220 |
| Vapour Pressure | 8.01E-08mmHg at 25°C |
| Index of Refraction | 1.726 |
| InChIKey | YFVNQUXNYCREJW-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1)oc1c3ccc(O)cc3oc(=O)c12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-Dihydroxy-9-methoxycoumestan |
| 6H-Benzofuro(3,2-c)(1)benzopyran-6-one,3,7-dihydroxy-9-methoxy |
| 3,7-Dihydroxy-9-methoxy-6H-benzofuro<3,2,c><1>benzopyran-6-on |
| 7,10-Dihydroxy-12-methoxy-coumestan |
| Trifoliol |