4-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2-methylbut-3-yn-2-ol structure
|
Common Name | 4-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2-methylbut-3-yn-2-ol | ||
|---|---|---|---|---|
| CAS Number | 185757-83-9 | Molecular Weight | 262.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2-methylbut-3-yn-2-ol |
|---|
| Molecular Formula | C16H22O3 |
|---|---|
| Molecular Weight | 262.34400 |
| Exact Mass | 262.15700 |
| PSA | 38.69000 |
| LogP | 2.75140 |
| InChIKey | LPUGNKYQLMDFCF-UHFFFAOYSA-N |
| SMILES | COc1c(C)c(C)c(OC)c(C#CC(C)(C)O)c1C |
|
~74%
4-(2,5-dimethox... CAS#:185757-83-9 |
| Literature: Tietze, Lutz F.; Goerlitzer, Jochen; Schuffenhauer, Ansgar; Huebner, Matthias European Journal of Organic Chemistry, 1999 , # 5 p. 1075 - 1084 |
|
~%
4-(2,5-dimethox... CAS#:185757-83-9 |
| Literature: Tietze, Lutz F.; Goerlitzer, Jochen; Schuffenhauer, Ansgar; Huebner, Matthias European Journal of Organic Chemistry, 1999 , # 5 p. 1075 - 1084 |