CID 121235356
Modify Date: 2026-07-17 14:29:34
CID 121235356 structure
|
Common Name | CID 121235356 | ||
|---|---|---|---|---|
| CAS Number | 1858224-03-9 | Molecular Weight | 1072.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C54H57NO22 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 121235356 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C54H57NO22 |
|---|---|
| Molecular Weight | 1072.0 |
| InChIKey | DNICDVYFYXDKKN-SPFNTYQRSA-N |
| SMILES | COC(=O)C1(OC2C(OC(=O)c3ccccc3)C(COC(=O)c3ccccc3)OC(Oc3ccc(OC)cc3)C2OC(=O)c2ccccc2)CC(OC(C)=O)C(NC(C)=O)C(C(OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of CID 121235356? |
| A: Molecular formula of CID 121235356 is C54H57NO22. |
| Q: What is the InChIKey of CID 121235356? |
| A: InChIKey of CID 121235356 is DNICDVYFYXDKKN-SPFNTYQRSA-N. |
| Q: What is the CAS number of CID 121235356? |
| A: CAS number of CID 121235356 is 1858224-03-9. |
| Q: What is the molecular weight of CID 121235356? |
| A: Molecular weight of CID 121235356 is 1072.0. |
| Q: What is the English name of CID 121235356? |
| A: The English name of CID 121235356 is CID 121235356. |
| Q: What is the Chinese name of 1858224-03-9? |
| A: Chinese name of 1858224-03-9 is 1858224-03-9. |
| Q: What is the SMILES notation of CID 121235356? |
| A: SMILES notation of CID 121235356 is COC(=O)C1(OC2C(OC(=O)c3ccccc3)C(COC(=O)c3ccccc3)OC(Oc3ccc(OC)cc3)C2OC(=O)c2ccccc2)CC(OC(C)=O)C(NC(C)=O)C(C(OC(C)=O)C(COC(C)=O)OC(C)=O)O1. |