Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride
Modify Date: 2026-07-16 23:44:07
Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride structure
|
Common Name | Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1858273-44-5 | Molecular Weight | 308.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15BrClNO2 |
|---|---|
| Molecular Weight | 308.60 |
| InChIKey | HFWWMEKLRSNJKK-PPHPATTJSA-N |
| SMILES | COC(=O)C(N)Cc1ccc(Br)c(C)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride? |
| A: InChIKey of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride is HFWWMEKLRSNJKK-PPHPATTJSA-N. |
| Q: What is the molecular formula of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride? |
| A: Molecular formula of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride is C11H15BrClNO2. |
| Q: What is the Chinese name of 1858273-44-5? |
| A: Chinese name of 1858273-44-5 is 1858273-44-5. |
| Q: What is the CAS number of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride? |
| A: CAS number of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride is 1858273-44-5. |
| Q: What is the molecular weight of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride? |
| A: Molecular weight of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride is 308.60. |
| Q: What is the SMILES notation of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride? |
| A: SMILES notation of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride is COC(=O)C(N)Cc1ccc(Br)c(C)c1.Cl. |
| Q: What is the English name of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride? |
| A: The English name of Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride is Methyl (S)-2-amino-3-(4-bromo-3-methylphenyl)propanoate hydrochloride. |