BENZYL 4-OXO-3,4-DIHYDROPYRIDINE-1(2H)-CARBOXYLATE structure
|
Common Name | BENZYL 4-OXO-3,4-DIHYDROPYRIDINE-1(2H)-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 185847-84-1 | Molecular Weight | 231.24700 | |
| Density | 1.245g/cm3 | Boiling Point | 382.2ºC at 760 mmHg | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | benzyl 4-oxo-2,3-dihydropyridine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 382.2ºC at 760 mmHg |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.24700 |
| Flash Point | 184.9ºC |
| Exact Mass | 231.09000 |
| PSA | 46.61000 |
| LogP | 2.04960 |
| Vapour Pressure | 4.81E-06mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | OAKHYPNVCUHASC-UHFFFAOYSA-N |
| SMILES | O=C1C=CN(C(=O)OCc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~80%
BENZYL 4-OXO-3,... CAS#:185847-84-1 |
| Literature: Knapp, Spencer; Yang, Chunhua; Pabbaraja, Srihari; Rempel, Brian; Reid, Steven; Withers, Stephen G. Journal of Organic Chemistry, 2005 , vol. 70, # 19 p. 7715 - 7720 |
|
~%
BENZYL 4-OXO-3,... CAS#:185847-84-1 |
| Literature: WO2007/64914 A2, ; Page/Page column 111 ; |
|
~75%
BENZYL 4-OXO-3,... CAS#:185847-84-1 |
| Literature: Yamada, Hironari; Aoyagi, Sakae; Kibayashi, Chihiro Tetrahedron Letters, 1996 , vol. 37, # 48 p. 8787 - 8790 |
|
~%
BENZYL 4-OXO-3,... CAS#:185847-84-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 20, # 7 p. 2195 - 2199 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4-dihydro-4-oxo-1(2H)-pyridinecarboxylic acid benzyl ester |
| N-carbobenzyloxy-2,3-dihydropyrid-4-one |
| 1-N-(benzyloxycarbonyl)-1,4,5,6-tetrahydro-4-pyridone |
| benzyl 3,4-dihydro-4-oxo-1(2H)-pyridinecarboxylate |
| Benzyl 4-oxo-3,4-dihydropyridine-1(2H)-carboxylate |
| 4-Oxo-3,4-dihydro-2H-pyridine-1-carboxylic acid benzyl ester |
| benzyl 2,3-dihydro-4-oxo-1H-pyridinecarboxylate |
| N-Cbz-dihydropyridin-4-one |