12H-Benzisoindolo<2,1-a>benzimidazol structure
|
Common Name | 12H-Benzisoindolo<2,1-a>benzimidazol | ||
|---|---|---|---|---|
| CAS Number | 18587-32-1 | Molecular Weight | 281.32900 | |
| Density | 1.387g/cm3 | Boiling Point | 542.9ºC at 760 mmHg | |
| Molecular Formula | C16H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.1ºC | |
| Name | 12H-Benzisoindolo<2,1-a>benzimidazol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 542.9ºC at 760 mmHg |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.32900 |
| Flash Point | 282.1ºC |
| Exact Mass | 281.05100 |
| PSA | 54.55000 |
| LogP | 4.94840 |
| Vapour Pressure | 7.56E-12mmHg at 25°C |
| Index of Refraction | 1.712 |
| InChIKey | LZPODVMZBAPLAL-UHFFFAOYSA-N |
| SMILES | O=S1(=O)c2ccccc2Nc2cc3ccccc3cc21 |
|
~%
12H-Benzisoindo... CAS#:18587-32-1 |
| Literature: Jackson; Morris; Turner Journal of the Chemical Society. Perkin transactions 1, 1968 , vol. 13, p. 1592 - 1593 |
|
~%
12H-Benzisoindo... CAS#:18587-32-1 |
| Literature: Jackson; Morris; Turner Journal of the Chemical Society. Perkin transactions 1, 1968 , vol. 13, p. 1592 - 1593 |
|
~%
12H-Benzisoindo... CAS#:18587-32-1 |
| Literature: Jackson; Morris; Turner Journal of the Chemical Society. Perkin transactions 1, 1968 , vol. 13, p. 1592 - 1593 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6H-Benzimidazo<2,1-a>benz<f>isoindol |
| Benzo<b>phenoxazin |
| benzo<b>phenoxazine |
| 12H-Benzo[f]benz[4,5]imidazo[2,1-a]isoindol |
| 12H-Benzo<b>phenothiazin-5-dioxid |
| 12H-Benzo[b]phenoxazin |
| 12H-benzo[f]benzo[4,5]imidazo[2,1-a]isoindole |
| 12H-benzo[b]phenothiazine 5,5-dioxide |
| 12H-benzo[f]benz[4,5]imidazo[2,1-a]isoindole |