3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid
Modify Date: 2026-07-07 20:58:39
3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid structure
|
Common Name | 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1858730-83-2 | Molecular Weight | 199.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13NO2S |
|---|---|
| Molecular Weight | 199.27 |
| InChIKey | TWCWFODSRIGPQX-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(C)(C)CC(=O)O)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid? |
| A: Molecular formula of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid is C9H13NO2S. |
| Q: What is the CAS number of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid? |
| A: CAS number of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid is 1858730-83-2. |
| Q: What is the Chinese name of 1858730-83-2? |
| A: Chinese name of 1858730-83-2 is 1858730-83-2. |
| Q: What is the SMILES notation of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid? |
| A: SMILES notation of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid is Cc1nc(C(C)(C)CC(=O)O)cs1. |
| Q: What is the molecular weight of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid? |
| A: Molecular weight of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid is 199.27. |
| Q: What is the InChIKey of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid? |
| A: InChIKey of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid is TWCWFODSRIGPQX-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid? |
| A: The English name of 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid is 3-Methyl-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid. |