Ethyldithiophosphonic acid S-[(2,4-dichlorophenoxy)methyl]=O-ethyl ester structure
|
Common Name | Ethyldithiophosphonic acid S-[(2,4-dichlorophenoxy)methyl]=O-ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 18596-51-5 | Molecular Weight | 345.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15Cl2O2PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,4-dichlorophenoxy)methylsulfanyl-ethoxy-ethyl-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H15Cl2O2PS2 |
|---|---|
| Molecular Weight | 345.24500 |
| Exact Mass | 343.96300 |
| PSA | 85.66000 |
| LogP | 6.07940 |
| Vapour Pressure | 9.98E-07mmHg at 25°C |
| InChIKey | ANDKQEZSSZZOHA-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(CC)SCOc1ccc(Cl)cc1Cl |
| HS Code | 2930909027 |
|---|
| HS Code | 2930909027 |
|---|---|
| Summary | 2930909027 。supervision conditions:23(import license for dual-use item and technologies,export license for dual-use item and technologies)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| N-5196 |
| Stauffer N-5196 |
| s-[(2,4-dichlorophenoxy)methyl] o-ethyl ethylphosphonodithioate |
| Phosphonodithioic acid,ethyl-,S-((2,4-dichlorophenoxy)methyl) O-ethyl ester |
| ENT 27,298 |