Fmoc-PNA-C(Bhoc)-OH structure
|
Common Name | Fmoc-PNA-C(Bhoc)-OH | ||
|---|---|---|---|---|
| CAS Number | 186046-81-1 | Molecular Weight | 701.724 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C39H35N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-PNA-C(Bhoc)-OHFmoc-PNA-C(Bhoc)-OH is a peptide nucleic acid monomers, and can be used in the synthesis of peptide nucleic acid compounds[1]. |
| Name | N-{[4-{[(Diphenylmethoxy)carbonyl]amino}-2-oxo-1(2H)-pyrimidinyl]acetyl}-N-(2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}ethyl)glycine |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-PNA-C(Bhoc)-OH is a peptide nucleic acid monomers, and can be used in the synthesis of peptide nucleic acid compounds[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Li Ziyin, et al. Peptide nucleic acid compound and preparation method thereof. Patent. CN104311642. |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C39H35N5O8 |
| Molecular Weight | 701.724 |
| Exact Mass | 701.248535 |
| LogP | 5.75 |
| Index of Refraction | 1.660 |
| InChIKey | YPTOIRLDQISSCH-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(CCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Cn1ccc(NC(=O)OC(c2ccccc2)c2ccccc2)nc1=O |
| MFCD22373799 |
| N-{[4-{[(Diphenylmethoxy)carbonyl]amino}-2-oxo-1(2H)-pyrimidinyl]acetyl}-N-(2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}ethyl)glycine |
| Glycine, N-[2-[4-[[(diphenylmethoxy)carbonyl]amino]-2-oxo-1(2H)-pyrimidinyl]acetyl]-N-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethyl]- |