5,6-Dihydro-6-methyl-4H-dibenzo[de,g]quinoline-10,11-dione structure
|
Common Name | 5,6-Dihydro-6-methyl-4H-dibenzo[de,g]quinoline-10,11-dione | ||
|---|---|---|---|---|
| CAS Number | 18605-40-8 | Molecular Weight | 41.052 | |
| Density | 0.7±0.1 g/cm3 | Boiling Point | 63.5±3.0 °C at 760 mmHg | |
| Molecular Formula | C2H3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 5.6±0.0 °C | |
| Name | Acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 0.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 63.5±3.0 °C at 760 mmHg |
| Molecular Formula | C2H3N |
| Molecular Weight | 41.052 |
| Flash Point | 5.6±0.0 °C |
| Exact Mass | 41.026550 |
| LogP | -0.45 |
| Vapour Pressure | 171.0±0.1 mmHg at 25°C |
| Index of Refraction | 1.331 |
| InChIKey | DZZIOGKZAPZOCK-UHFFFAOYSA-N |
| SMILES | CN1CCc2cccc3c4c(cc1c23)C=CC(=O)C4=O |
| Methane, cyano- |
| MeCN |
| MFCD00001878 |
| 741857 |
| Acetonitrile ZerO2(R) |
| ethanonitrile |
| NCMe |
| Residual Solvent - Acetonitrile |
| Degassed and low oxygen acetonitrile |
| Amidite Diluent |
| EINECS 232-148-9 |
| Ethyl nitrile |
| Residual Solvent Class 2 - Acetonitrile |
| etanonitrile |
| Methylidyne, cyano- |
| Ethanenitrile |
| methyl cyanide |
| Acetonitrile |
| Ethane nitrile |
| Alcohol Determination - Acetonitrile |
| EINECS 200-664-3 |
| cyanomethane |
| NC1 |
| EINECS 200-835-2 |