2,4,6(1H,3H,5H)-Pyrimidinetrione,1-methyl-5-(1-methylethyl)-5-(2-propen-1-yl)- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,1-methyl-5-(1-methylethyl)-5-(2-propen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 1861-21-8 | Molecular Weight | 224.25600 | |
| Density | 1.106g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-5-propan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Exact Mass | 224.11600 |
| PSA | 66.48000 |
| LogP | 1.17980 |
| Index of Refraction | 1.483 |
| InChIKey | AXJXURWWUFZZKN-UHFFFAOYSA-N |
| SMILES | C=CCC1(C(C)C)C(=O)NC(=O)N(C)C1=O |
| HS Code | 2933540000 |
|---|
|
~%
2,4,6(1H,3H,5H)... CAS#:1861-21-8 |
| Literature: Hoffmann-La Roche Patent: US2072829 , 1936 ; |
|
~%
2,4,6(1H,3H,5H)... CAS#:1861-21-8 |
| Literature: Hoffmann-La Roche Patent: US2072829 , 1936 ; Full Text Show Details Hoffmann-La Roche Patent: DE655530 , 1936 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 24, p. 353 |
|
~%
2,4,6(1H,3H,5H)... CAS#:1861-21-8 |
| Literature: Hoffmann-La Roche Patent: US2072829 , 1936 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| n-methyl-5-allyl-5-isopropylbarbituric acid |
| Enallylpropymal |
| N-Methyl-allyl-isopropyl-barbitursaeure |
| 5-allyl-5-isopropyl-1-methyl-pyrimidine-2,4,6-trione |
| Barbituric acid,5-allyl-5-isopropyl-1-methyl |
| Narconumal |
| 1-Methyl-5-isopropyl-5-allyl-barbitursaeure |
| 1-methyl-5-(1-methylethyl)-5-(2-propenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione |
| 5-Allyl-5-isopropyl-1-methylbarbituric acid |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione,1-methyl-5-(1-methylethyl)-5-(2-propenyl) |
| 5-Allyl-5-isopropyl-1-methyl-barbitursaeure |