6-[2-(Diethylamino)ethoxy]-3-pyridinecarboxylic acid ethyl ester structure
|
Common Name | 6-[2-(Diethylamino)ethoxy]-3-pyridinecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 18617-51-1 | Molecular Weight | 266.33600 | |
| Density | 1.061g/cm3 | Boiling Point | 357.8ºC at 760 mmHg | |
| Molecular Formula | C14H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.2ºC | |
| Name | ethyl 6-[2-(diethylamino)ethoxy]pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 357.8ºC at 760 mmHg |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.33600 |
| Flash Point | 170.2ºC |
| Exact Mass | 266.16300 |
| PSA | 51.66000 |
| LogP | 1.97890 |
| Vapour Pressure | 2.66E-05mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | MCRNVQMZPKKJNG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OCCN(CC)CC)nc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-<2-Diethylamino-ethoxy>-nicotinsaeure-ethylester |