3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione
Modify Date: 2025-09-17 06:56:46
![3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione Structure](https://www.chemsrc.com/extcaspic/341/1861941-88-9.png)
3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione structure
|
Common Name | 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione | ||
|---|---|---|---|---|
| CAS Number | 1861941-88-9 | Molecular Weight | 304.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H14BrNO2S |
|---|---|
| Molecular Weight | 304.21 |
| InChIKey | JVKWCANUEIAVDE-UHFFFAOYSA-N |
| SMILES | Cc1cc(CNC2CS(=O)(=O)C2)ccc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione? |
| A: CAS number of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione is 1861941-88-9. |
| Q: What is the molecular weight of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione? |
| A: Molecular weight of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione is 304.21. |
| Q: What is the English name of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione? |
| A: The English name of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione is 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione. |
| Q: What is the Chinese name of 1861941-88-9? |
| A: Chinese name of 1861941-88-9 is 1861941-88-9. |
| Q: What is the molecular formula of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione? |
| A: Molecular formula of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione is C11H14BrNO2S. |
| Q: What is the InChIKey of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione? |
| A: InChIKey of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione is JVKWCANUEIAVDE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione? |
| A: SMILES notation of 3-{[(4-Bromo-3-methylphenyl)methyl]amino}-1lambda6-thietane-1,1-dione is Cc1cc(CNC2CS(=O)(=O)C2)ccc1Br. |